Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-(3-Amino-4-Methylphenyl)-N-Ethylacetamide |
|---|---|
| Synonyms | N-(3-Amino-4-Methyl-Phenyl)-N-Ethyl-Acetamide; N-(3-Amino-4-Methyl-Phenyl)-N-Ethyl-Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 |
| CAS Registry Number | 6375-70-8 |
| EINECS | 228-941-4 |
| SMILES | C1=C(N(C(=O)C)CC)C=CC(=C1N)C |
| InChI | 1S/C11H16N2O/c1-4-13(9(3)14)10-6-5-8(2)11(12)7-10/h5-7H,4,12H2,1-3H3 |
| InChIKey | DAOVJXMODJTKDC-UHFFFAOYSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.317°C at 760 mmHg (Cal.) |
| Flash point | 171.109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Amino-4-Methylphenyl)-N-Ethylacetamide |