Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 2-Acetyl-3-Oxo-Hexanoate |
|---|---|
| Synonyms | Ethyl 2-Acetyl-3-Oxo-Hexanoate; 2-Acetyl-3-Oxohexanoic Acid Ethyl Ester; 2-Acetyl-3-Keto-Hexanoic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 63765-76-4 |
| SMILES | C(OC(=O)C(C(=O)CCC)C(=O)C)C |
| InChI | 1S/C10H16O4/c1-4-6-8(12)9(7(3)11)10(13)14-5-2/h9H,4-6H2,1-3H3 |
| InChIKey | ADNFJNFZZOQJKK-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.662°C at 760 mmHg (Cal.) |
| Flash point | 110.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Acetyl-3-Oxo-Hexanoate |