Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Trimethyl(tetracyclo[2.2.0.02,6.03,5]hex-1-yl)silane |
|---|---|
| Synonyms | trimethyl((1R,2S,3R,4R)-prisman-1-yl)silane |
| Molecular Structure | ![CAS#: 638195-88-7， Trimethyl(tetracyclo[2.2.0.0<sup>2,6</sup>.0<sup>3,5</sup>]hex-1-yl)silane](/moreStructures/638195-88-7.gif) |
| Molecular Formula | C9H14Si |
| Molecular Weight | 150.29 |
| CAS Registry Number | 638195-88-7 |
| SMILES | C[Si](C)(C)C12C3C4C3C1C24 |
| InChI | 1S/C9H14Si/c1-10(2,3)9-6-4-5(6)8(9)7(4)9/h4-8H,1-3H3 |
| InChIKey | VEDXIGGKGULGBW-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 143.204°C at 760 mmHg (Cal.) |
| Flash point | 25.402°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl(tetracyclo[2.2.0.02,6.03,5]hex-1-yl)silane |