Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Bromo-N-cyclopropylnicotinamide 1-oxide |
|---|---|
| Synonyms | 3-bromo-5-(cyclopropylcarbamoyl)pyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.08 |
| CAS Registry Number | 638219-62-2 |
| SMILES | c1c(c[n+](cc1Br)[O-])C(=O)NC2CC2 |
| InChI | 1S/C9H9BrN2O2/c10-7-3-6(4-12(14)5-7)9(13)11-8-1-2-8/h3-5,8H,1-2H2,(H,11,13) |
| InChIKey | GQRPVRFAIYKNCX-UHFFFAOYSA-N |
| Density | 1.797g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.752°C at 760 mmHg (Cal.) |
| Flash point | 267.532°C (Cal.) |
| Refractive index | 1.698 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-N-cyclopropylnicotinamide 1-oxide |