|
CAS#: 63834-13-9 Product: N,N-Diethyl-2-(10H-Phenothiazin-10-Yl)-2-Propanamine No suppilers available for the product. |
| Name | N,N-Diethyl-2-(10H-Phenothiazin-10-Yl)-2-Propanamine |
|---|---|
| Synonyms | 10-(α-Methyl-α-diethylaminoethyl)phenothiazine; Phenothiazine, 10-(1-methyl-1-diethylaminoethyl)-; USAF XR-9 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.47 |
| CAS Registry Number | 63834-13-9 |
| SMILES | S2c1ccccc1N(c3c2cccc3)C(N(CC)CC)(C)C |
| InChI | 1S/C19H24N2S/c1-5-20(6-2)19(3,4)21-15-11-7-9-13-17(15)22-18-14-10-8-12-16(18)21/h7-14H,5-6H2,1-4H3 |
| InChIKey | JTJURXUHFKXPOT-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.346°C at 760 mmHg (Cal.) |
| Flash point | 206.808°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-2-(10H-Phenothiazin-10-Yl)-2-Propanamine |