Online Database of Chemicals from Around the World
|
CAS#: 63834-18-4 Product: 1-(10H-Phenothiazin-10-Yl)-2-(1-Pyrrolidinyl)-1-Propanone No suppilers available for the product. |
| Name | 1-(10H-Phenothiazin-10-Yl)-2-(1-Pyrrolidinyl)-1-Propanone |
|---|---|
| Synonyms | 1-(10H-PHENOTHIAZIN-10-YL)-2-(PYRROLIDIN-1-YL)PROPAN-1-ONE; 10-(α-Pyrrolidinylpropionyl)phenothiazine; 4-27-00-01277 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.44 |
| CAS Registry Number | 63834-18-4 |
| SMILES | O=C(N1c3c(Sc2c1cccc2)cccc3)C(N4CCCC4)C |
| InChI | 1S/C19H20N2OS/c1-14(20-12-6-7-13-20)19(22)21-15-8-2-4-10-17(15)23-18-11-5-3-9-16(18)21/h2-5,8-11,14H,6-7,12-13H2,1H3 |
| InChIKey | AUXLHDRYVJNWFW-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.796°C at 760 mmHg (Cal.) |
| Flash point | 273.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(10H-Phenothiazin-10-Yl)-2-(1-Pyrrolidinyl)-1-Propanone |