Online Database of Chemicals from Around the World
|
CAS#: 63887-00-3 Product: 5-Bromo-2-(2-Hydroxyethoxy)Benzamide No suppilers available for the product. |
| Name | 5-Bromo-2-(2-Hydroxyethoxy)Benzamide |
|---|---|
| Synonyms | Brn 3276624; 4-10-00-00220 (Beilstein Handbook Reference); 5-Bromo-2-(Beta-Hydroxyethoxy)Benzamide |
| Molecular Structure |  |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 |
| CAS Registry Number | 63887-00-3 |
| SMILES | C1=CC(=CC(=C1OCCO)C(N)=O)Br |
| InChI | 1S/C9H10BrNO3/c10-6-1-2-8(14-4-3-12)7(5-6)9(11)13/h1-2,5,12H,3-4H2,(H2,11,13) |
| InChIKey | DKPDJFHVGNUHSL-UHFFFAOYSA-N |
| Density | 1.602g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.445°C at 760 mmHg (Cal.) |
| Flash point | 189.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-2-(2-Hydroxyethoxy)Benzamide |