Online Database of Chemicals from Around the World
|
CAS#: 63906-99-0 Product: 2-Chloro-2-Nitro-3-Nonanol No suppilers available for the product. |
| Name | 2-Chloro-2-Nitro-3-Nonanol |
|---|---|
| Synonyms | 2-Chloro-2-Nitro-Nonan-3-Ol; 2-Chloro-2-Nitro-3-Nonanol; 3-Nonanol, 2-Chloro-2-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C9H18ClNO3 |
| Molecular Weight | 223.70 |
| CAS Registry Number | 63906-99-0 |
| SMILES | C(C(O)C(Cl)([N+]([O-])=O)C)CCCCC |
| InChI | 1S/C9H18ClNO3/c1-3-4-5-6-7-8(12)9(2,10)11(13)14/h8,12H,3-7H2,1-2H3 |
| InChIKey | TVJDCJVCGXSILJ-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.189°C at 760 mmHg (Cal.) |
| Flash point | 135.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-2-Nitro-3-Nonanol |