Online Database of Chemicals from Around the World
|
CAS#: 63919-16-4 Product: Isonicotinthioamide 1-Oxide No suppilers available for the product. |
| Name | Isonicotinthioamide 1-Oxide |
|---|---|
| Synonyms | 1-Oxido-4-Pyridin-1-Iumcarbothioamide; 4-Pyridinecarbothioamide, 1-Oxide; Isonicotinamide, Thio-, 1-Oxide |
| Molecular Structure |  |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 |
| CAS Registry Number | 63919-16-4 |
| SMILES | C1=C[N+](=CC=C1C(N)=S)[O-] |
| InChI | 1S/C6H6N2OS/c7-6(10)5-1-3-8(9)4-2-5/h1-4H,(H2,7,10) |
| InChIKey | QXWRJQUCWGFCGJ-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.943°C at 760 mmHg (Cal.) |
| Flash point | 210.798°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isonicotinthioamide 1-Oxide |