|
CAS#: 63990-91-0 Product: alpha-Cyclohexyl-alpha-(3-Pyridyl)Benzyl Alcohol Hydrochloride No suppilers available for the product. |
| Name | alpha-Cyclohexyl-alpha-(3-Pyridyl)Benzyl Alcohol Hydrochloride |
|---|---|
| Synonyms | Cyclohexyl-Phenyl-Pyridin-1-Ium-3-Yl-Methanol Chloride; Cyclohexyl-Phenyl-(3-Pyridin-1-Iumyl)Methanol Chloride; El-331 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 |
| CAS Registry Number | 63990-91-0 |
| SMILES | C3=C(C(O)(C1CCCCC1)C2=CC=CC=C2)C=CC=[NH+]3.[Cl-] |
| InChI | 1S/C18H21NO.ClH/c20-18(15-8-3-1-4-9-15,16-10-5-2-6-11-16)17-12-7-13-19-14-17;/h1,3-4,7-9,12-14,16,20H,2,5-6,10-11H2;1H |
| InChIKey | RLADIDBSFKIKLB-UHFFFAOYSA-N |
| Boiling point | 433.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 215.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Cyclohexyl-alpha-(3-Pyridyl)Benzyl Alcohol Hydrochloride |