Online Database of Chemicals from Around the World
|
CAS#: 63991-52-6 Product: 9-Ethylbenz[e]Indeno[1,2-b]Indole No suppilers available for the product. |
| Name | 9-Ethylbenz[e]Indeno[1,2-b]Indole |
|---|---|
| Synonyms | Benz(E)Indeno(1,2-B)Indole, 9-Ethyl- |
| Molecular Structure | ![CAS#: 63991-52-6， 9-Ethylbenz[e]Indeno[1,2-b]Indole](/moreStructures/63991-52-6.gif) |
| Molecular Formula | C21H15N |
| Molecular Weight | 281.36 |
| CAS Registry Number | 63991-52-6 |
| SMILES | C5=C4C3=C1C(=C2C(=C1)C=CC(=C2)CC)N=C3C=CC4=CC=C5 |
| InChI | 1S/C21H15N/c1-2-13-7-8-15-12-18-20-16-6-4-3-5-14(16)9-10-19(20)22-21(18)17(15)11-13/h3-12H,2H2,1H3 |
| InChIKey | DTCAHTNWKBPKRS-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.671°C at 760 mmHg (Cal.) |
| Flash point | 230.705°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Ethylbenz[e]Indeno[1,2-b]Indole |