Online Database of Chemicals from Around the World
|
CAS#: 63991-99-1 Product: 3-(3-Nitrophenoxy)-1,2-Propanediol No suppilers available for the product. |
| Name | 3-(3-Nitrophenoxy)-1,2-Propanediol |
|---|---|
| Synonyms | 1,2-Propanediol, 3-(M-Nitrophenoxy)-; 3-(M-Nitrophenoxy)-1,2-Propanediol |
| Molecular Structure |  |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 63991-99-1 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1OCC(O)CO |
| InChI | 1S/C9H11NO5/c11-5-8(12)6-15-9-3-1-2-7(4-9)10(13)14/h1-4,8,11-12H,5-6H2 |
| InChIKey | HJYXCTLKGAOVHQ-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.348°C at 760 mmHg (Cal.) |
| Flash point | 217.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Nitrophenoxy)-1,2-Propanediol |