Online Database of Chemicals from Around the World
|
CAS#: 63992-60-9 Product: 4,6-Dibromo-2-Methylresorcinol No suppilers available for the product. |
| Name | 4,6-Dibromo-2-Methylresorcinol |
|---|---|
| Synonyms | 4,6-Dibromo-2-Methyl-Benzene-1,3-Diol; 4,6-Dibromo-2-Methyl-Resorcinol; Brn 2521399 |
| Molecular Structure |  |
| Molecular Formula | C7H6Br2O2 |
| Molecular Weight | 281.93 |
| CAS Registry Number | 63992-60-9 |
| SMILES | C1=C(Br)C(=C(C(=C1Br)O)C)O |
| InChI | 1S/C7H6Br2O2/c1-3-6(10)4(8)2-5(9)7(3)11/h2,10-11H,1H3 |
| InChIKey | NJIVTNAPTHUGDR-UHFFFAOYSA-N |
| Density | 2.089g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.562°C at 760 mmHg (Cal.) |
| Flash point | 169.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dibromo-2-Methylresorcinol |