|
CAS#: 64-31-3 Product: Morphine sulfate No suppilers available for the product. |
| Classification | Organic raw materials >> Organometallic compound >> Organic sodium |
|---|---|
| Name | Morphine sulfate |
| Synonyms | Kapanol; Mst-1 Continus |
| Molecular Structure | ![]() |
| Molecular Formula | C34H40N2O10S |
| Molecular Weight | 668.76 |
| CAS Registry Number | 64-31-3 |
| EINECS | 200-582-8 |
| SMILES | [NH+]5([C@@H]1[C@@H]4[C@@]3(C2=C(C1)C=CC(=C2OC3[C@H](O)C=C4)O)CC5)C.[NH+]%10([C@@H]6[C@@H]9[C@@]8(C7=C(C6)C=CC(=C7OC8[C@H](O)C=C9)O)CC%10)C.O=[S]([O-])([O-])=O |
| InChI | 1S/2C17H19NO3.H2O4S/c2*1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;1-5(2,3)4/h2*2-5,10-11,13,16,19-20H,6-8H2,1H3;(H2,1,2,3,4)/t2*10-,11+,13-,16?,17-;/m11./s1 |
| InChIKey | USAHOPJHPJHUNS-TXCKYYANSA-N |
| Boiling point | 476.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 241.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Morphine sulfate |