Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Octahydro-4,7-Methano-1H-Inden-5-Ol 5-Acetate |
|---|---|
| Synonyms | 4,7-Methano-1H-Inden-5-Ol, Octahydro-, Acetate, (3Ar,4S,5R,7S,7Ar)-Rel-; 4,7-Methano-1H-Inden-5-Ol, Octahydro-, Acetate |
| Molecular Structure |  |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 64001-15-6 |
| EINECS | 238-336-7 |
| SMILES | CC(OC3C2C1C(CCC1)C(C2)C3)=O |
| InChI | 1S/C12H18O2/c1-7(13)14-12-6-8-5-11(12)10-4-2-3-9(8)10/h8-12H,2-6H2,1H3 |
| InChIKey | YKFHIJHJBUDXFP-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.468°C at 760 mmHg (Cal.) |
| Flash point | 103.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-4,7-Methano-1H-Inden-5-Ol 5-Acetate |