| Axon MedChem BV | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2-Chloro-6-(1-Piperazinyl)-Pyrazine |
|---|---|
| Synonyms | 2-Chloro-6-Piperazin-1-Yl-Pyrazine Hydrochloride; 2-Chloro-6-(1-Piperazinyl)Pyrazine Hydrochloride; 1-(6-Chloro-2-Pyrazinyl)Piperazine Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12Cl2N4 |
| Molecular Weight | 235.12 |
| CAS Registry Number | 64022-27-1 |
| SMILES | [H+].C2=C(N1CCNCC1)N=C(Cl)C=N2.[Cl-] |
| InChI | 1S/C8H11ClN4.ClH/c9-7-5-11-6-8(12-7)13-3-1-10-2-4-13;/h5-6,10H,1-4H2;1H |
| InChIKey | PFIZGLUIYAZQFU-UHFFFAOYSA-N |
| Boiling point | 364.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174°C (Cal.) |
| solubility | Soluble to 50 mM in water |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-(1-Piperazinyl)-Pyrazine |