Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(Trifluoromethyl)-2-pyridinecarbonyl chloride |
|---|---|
| Synonyms | 2-Pyridinecarbonyl chloride, 4-(trifluoromethyl)-; 4-(trifluoromethyl)picolinoyl chloride |
| Molecular Structure |  |
| Molecular Formula | C7H3ClF3NO |
| Molecular Weight | 209.55 |
| CAS Registry Number | 640296-12-4 |
| SMILES | c1cnc(cc1C(F)(F)F)C(=O)Cl |
| InChI | 1S/C7H3ClF3NO/c8-6(13)5-3-4(1-2-12-5)7(9,10)11/h1-3H |
| InChIKey | WHWACFJPBBMJJG-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.413°C at 760 mmHg (Cal.) |
| Flash point | 91.941°C (Cal.) |
| Refractive index | 1.467 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Trifluoromethyl)-2-pyridinecarbonyl chloride |