Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,4,5-Triaminoanthraquinone |
|---|---|
| Synonyms | 1,4,5-Triamino-9,10-Anthraquinone; 1,4,5-Triaminoanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 |
| CAS Registry Number | 6407-69-8 |
| EINECS | 229-037-2 |
| SMILES | C3=C(C1=C(C(C2=C(C1=O)C(=CC=C2)N)=O)C(=C3)N)N |
| InChI | 1S/C14H11N3O2/c15-7-3-1-2-6-10(7)14(19)12-9(17)5-4-8(16)11(12)13(6)18/h1-5H,15-17H2 |
| InChIKey | MKARJQUHEFPSDM-UHFFFAOYSA-N |
| Density | 1.527g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.631°C at 760 mmHg (Cal.) |
| Flash point | 335.798°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,5-Triaminoanthraquinone |