Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Chlorobenzanthrone |
|---|---|
| Synonyms | 3-Chloro-7H-Benz[De]Anthracen-7-One; Aids-017947; Aids017947 |
| Molecular Structure |  |
| Molecular Formula | C17H9ClO |
| Molecular Weight | 264.71 |
| CAS Registry Number | 6409-44-5 |
| EINECS | 229-082-8 |
| SMILES | C1=CC=CC4=C1C3=C2C(=CC=CC2=C(C=C3)Cl)C4=O |
| InChI | 1S/C17H9ClO/c18-15-9-8-11-10-4-1-2-5-12(10)17(19)14-7-3-6-13(15)16(11)14/h1-9H |
| InChIKey | QLCFFBOGHZDLGO-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.036°C at 760 mmHg (Cal.) |
| Flash point | 240.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chlorobenzanthrone |