Online Database of Chemicals from Around the World
| Name | 1,2-Dihydroaceanthrylene |
|---|---|
| Synonyms | Aceanthrene; Aceanthrylene, 1,2-Dihydro- |
| Molecular Structure |  |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 641-48-5 |
| SMILES | C1=C4C3=C(C2=C1C=CC=C2)CCC3=CC=C4 |
| InChI | 1S/C16H12/c1-2-7-14-12(4-1)10-13-6-3-5-11-8-9-15(14)16(11)13/h1-7,10H,8-9H2 |
| InChIKey | XTAHYROJKCXMOF-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.503°C at 760 mmHg (Cal.) |
| Flash point | 187.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydroaceanthrylene |
