|
CAS#: 641-57-6 Product: 7,9-Diphenyl-8H-Cyclopent[a]Acenaphthylen-8-One No suppilers available for the product. |
| Name | 7,9-Diphenyl-8H-Cyclopent[a]Acenaphthylen-8-One |
|---|---|
| Synonyms | Aids-132878; Aids132878; Nsc627663 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H16O |
| Molecular Weight | 356.42 |
| CAS Registry Number | 641-57-6 |
| SMILES | C6=CC=C(C2=C3C(=C(C1=CC=CC=C1)C2=O)C4=CC=CC5=CC=CC3=C45)C=C6 |
| InChI | 1S/C27H16O/c28-27-23(18-9-3-1-4-10-18)25-20-15-7-13-17-14-8-16-21(22(17)20)26(25)24(27)19-11-5-2-6-12-19/h1-16H |
| InChIKey | QQGHPFDLUNMBGJ-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 660.924°C at 760 mmHg (Cal.) |
| Flash point | 291.575°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7,9-Diphenyl-8H-Cyclopent[a]Acenaphthylen-8-One |