Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (5alpha)-Pregnane |
|---|---|
| Synonyms | Pregnane, (5.Beta.)-; (5-Alpha)-Pregnane; 5Alpha-Pregnane |
| Molecular Structure |  |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 |
| CAS Registry Number | 641-85-0 |
| EINECS | 211-378-3 |
| SMILES | C(C4C3(C(C1C(C2(C(CC1)CCCC2)C)CC3)CC4)C)C |
| InChI | 1S/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3 |
| InChIKey | JWMFYGXQPXQEEM-UHFFFAOYSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.281°C at 760 mmHg (Cal.) |
| Flash point | 162.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5alpha)-Pregnane |