Online Database of Chemicals from Around the World
|
CAS#: 6423-45-6 Product: 2,3-Butanediol, Dinitrate No suppilers available for the product. |
| Name | 2,3-Butanediol, Dinitrate |
|---|---|
| Synonyms | (1-Methyl-2-Nitrooxy-Propyl) Nitrate; Nitric Acid (1-Methyl-2-Nitrooxypropyl) Ester; Nitric Acid (1-Methyl-2-Nitrooxy-Propyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C4H8N2O6 |
| Molecular Weight | 180.12 |
| CAS Registry Number | 6423-45-6 |
| SMILES | CC(O[N+]([O-])=O)C(O[N+](=O)[O-])C |
| InChI | 1S/C4H8N2O6/c1-3(11-5(7)8)4(2)12-6(9)10/h3-4H,1-2H3 |
| InChIKey | RVDDYBGRQLZMSB-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.627°C at 760 mmHg (Cal.) |
| Flash point | 95.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Butanediol, Dinitrate |