Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Nitro-1H-benzimidazol-6-ol |
|---|---|
| Synonyms | 1H-Benzimidazol-5-ol,7-nitro-; 7-nitro-1H-benzo[d]imidazol-5-ol |
| Molecular Structure |  |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.13 |
| CAS Registry Number | 64265-11-8 |
| SMILES | [O-][N+](=O)c1cc(O)cc2ncnc12 |
| InChI | 1S/C7H5N3O3/c11-4-1-5-7(9-3-8-5)6(2-4)10(12)13/h1-3,11H,(H,8,9) |
| InChIKey | KQZYLWARAWRASU-UHFFFAOYSA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.981°C at 760 mmHg (Cal.) |
| Flash point | 296.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-1H-benzimidazol-6-ol |