|
CAS#: 642941-68-2 Product: (2E)-3-(4-Fluorophenyl)acrylamide No suppilers available for the product. |
| Name | (2E)-3-(4-Fluorophenyl)acrylamide |
|---|---|
| Synonyms | (2E)-3-(4-fluorophenyl)prop-2-enamide; (E)-3-(4-fluorophenyl)acrylamide; 2-Propenamide,3-(4-fluorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.16 |
| CAS Registry Number | 642941-68-2 |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)N)F |
| InChI | 1S/C9H8FNO/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H2,11,12)/b6-3+ |
| InChIKey | PNUAPSQYVPLFAN-ZZXKWVIFSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.5±34.0°C at 760 mmHg (Cal.) |
| Flash point | 164.0±25.7°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-(4-Fluorophenyl)acrylamide |