Online Database of Chemicals from Around the World
|
CAS#: 643015-28-5 Product: (2E)-3-Amino-2-(1H-inden-3-yl)-2-butenenitrile No suppilers available for the product. |
| Name | (2E)-3-Amino-2-(1H-inden-3-yl)-2-butenenitrile |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 643015-28-5 |
| SMILES | C/C(=C(\C#N)/C1=CCc2c1cccc2)/N |
| InChI | 1S/C13H12N2/c1-9(15)13(8-14)12-7-6-10-4-2-3-5-11(10)12/h2-5,7H,6,15H2,1H3/b13-9- |
| InChIKey | IVBLXOWRXXHZPQ-LCYFTJDESA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.017°C at 760 mmHg (Cal.) |
| Flash point | 226.567°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-Amino-2-(1H-inden-3-yl)-2-butenenitrile |