Online Database of Chemicals from Around the World
|
CAS#: 64346-57-2 Product: 2,5-Xylyl 3,4-Xylyl Disulphide No suppilers available for the product. |
| Name | 2,5-Xylyl 3,4-Xylyl Disulphide |
|---|---|
| Synonyms | 4-(2,5-Dimethylphenyl)Disulfanyl-1,2-Dimethyl-Benzene; 2,5-Xylyl 3,4-Xylyl Disulphide; Disulfide, 2,5-Dimethylphenyl 3,4-Dimethylphenyl |
| Molecular Structure |  |
| Molecular Formula | C16H18S2 |
| Molecular Weight | 274.44 |
| CAS Registry Number | 64346-57-2 |
| EINECS | 264-807-1 |
| SMILES | C1=C(C=CC(=C1SSC2=CC(=C(C=C2)C)C)C)C |
| InChI | 1S/C16H18S2/c1-11-5-6-13(3)16(9-11)18-17-15-8-7-12(2)14(4)10-15/h5-10H,1-4H3 |
| InChIKey | BISHVFDSLHDEFN-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.435°C at 760 mmHg (Cal.) |
| Flash point | 192.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Xylyl 3,4-Xylyl Disulphide |