Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-(1-Cyanopropyl)benzoyl chloride |
|---|---|
| Synonyms | 3-(1-cyanopropyl)benzoyl chloride |
| Molecular Structure |  |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 |
| CAS Registry Number | 64379-73-3 |
| SMILES | CCC(C#N)c1cccc(c1)C(Cl)=O |
| InChI | 1S/C11H10ClNO/c1-2-8(7-13)9-4-3-5-10(6-9)11(12)14/h3-6,8H,2H2,1H3 |
| InChIKey | WBLOYRJQZHIFPL-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.08°C at 760 mmHg (Cal.) |
| Flash point | 147.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Cyanopropyl)benzoyl chloride |