Online Database of Chemicals from Around the World
|
CAS#: 644-59-7 Product: 4-Chloro-5-Hydrazino-1,3-Benzenedisulfonamide No suppilers available for the product. |
| Name | 4-Chloro-5-Hydrazino-1,3-Benzenedisulfonamide |
|---|---|
| Synonyms | 4-Chloro-5-Hydrazino-Benzene-1,3-Disulfonamide; 4-Chloro-5-Hydrazinobenzene-1,3-Disulfonamide; 4-Chloro-5-Hydrazinyl-Benzene-1,3-Disulfonamide |
| Molecular Structure |  |
| Molecular Formula | C6H9ClN4O4S2 |
| Molecular Weight | 300.73 |
| CAS Registry Number | 644-59-7 |
| SMILES | C1=C([S](=O)(=O)N)C=C(C(=C1[S](=O)(=O)N)Cl)NN |
| InChI | 1S/C6H9ClN4O4S2/c7-6-4(11-8)1-3(16(9,12)13)2-5(6)17(10,14)15/h1-2,11H,8H2,(H2,9,12,13)(H2,10,14,15) |
| InChIKey | LYXKZPRZTAOOHD-UHFFFAOYSA-N |
| Density | 1.813g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.146°C at 760 mmHg (Cal.) |
| Flash point | 327.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-5-Hydrazino-1,3-Benzenedisulfonamide |