Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-(1,2,3,4-Tetrahydro-1-isoquinolinylmethyl)benzamide |
|---|---|
| Synonyms | 1-((Benzamido)methyl)-1,2,3,4-tetrahydroisoquinoline; N-((1,2,3,4-Tetrahydro-1-isoquinolinyl)methyl)benzamide |
| Molecular Structure |  |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 |
| CAS Registry Number | 64411-74-1 |
| SMILES | O=C(c1ccccc1)NCC3c2c(cccc2)CCN3 |
| InChI | 1S/C17H18N2O/c20-17(14-7-2-1-3-8-14)19-12-16-15-9-5-4-6-13(15)10-11-18-16/h1-9,16,18H,10-12H2,(H,19,20) |
| InChIKey | NAFKORXBGRILHW-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.079°C at 760 mmHg (Cal.) |
| Flash point | 195.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1,2,3,4-Tetrahydro-1-isoquinolinylmethyl)benzamide |