Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[4-(3-Methylbutyl)phenyl]propanoic acid |
|---|---|
| Synonyms | 2-(4-isopentylphenyl)propanoic acid |
| Molecular Structure | ![CAS#: 64451-77-0， 2-[4-(3-Methylbutyl)phenyl]propanoic acid](/moreStructures/64451-77-0.gif) |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 64451-77-0 |
| SMILES | O=C(O)C(c1ccc(cc1)CCC(C)C)C |
| InChI | 1S/C14H20O2/c1-10(2)4-5-12-6-8-13(9-7-12)11(3)14(15)16/h6-11H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | HHFVQOIVAHITEG-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.084°C at 760 mmHg (Cal.) |
| Flash point | 232.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(3-Methylbutyl)phenyl]propanoic acid |