|
CAS#: 64508-50-5 Product: 2-Methoxybenzoic anhydride No suppilers available for the product. |
| Name | 2-Methoxybenzoic anhydride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 |
| CAS Registry Number | 64508-50-5 |
| SMILES | COc1ccccc1C(=O)OC(=O)c2ccccc2OC |
| InChI | 1S/C16H14O5/c1-19-13-9-5-3-7-11(13)15(17)21-16(18)12-8-4-6-10-14(12)20-2/h3-10H,1-2H3 |
| InChIKey | CPPYQMZQDONVGK-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.504°C at 760 mmHg (Cal.) |
| Flash point | 202.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxybenzoic anhydride |