Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Naphtho[2,3-b]furan-4,9-diol |
|---|---|
| Synonyms | naphtho[2,3-b]furan-4,9-diol |
| Molecular Structure | ![CAS#: 645413-89-4， Naphtho[2,3-b]furan-4,9-diol](/moreStructures/645413-89-4.gif) |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 645413-89-4 |
| SMILES | c1ccc2c(c1)c(c3ccoc3c2O)O |
| InChI | 1S/C12H8O3/c13-10-7-3-1-2-4-8(7)11(14)12-9(10)5-6-15-12/h1-6,13-14H |
| InChIKey | ZLNMFKYGGBXDJX-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.598°C at 760 mmHg (Cal.) |
| Flash point | 118.058°C (Cal.) |
| Refractive index | 1.787 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphtho[2,3-b]furan-4,9-diol |