|
CAS#: 64546-10-7 Product: alpha-Hydroxyetizolam No suppilers available for the product. |
| Name | alpha-Hydroxyetizolam |
|---|---|
| Synonyms | 6H-Thieno(3,2-F)(1,2,4)Triazolo(4,3-A)(1,4)Diazepine-2-Methanol, (2-Chlorophenyl)-Alpha,9-Dimethyl-; Alpha-Hydroxyetizolam |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.84 |
| CAS Registry Number | 64546-10-7 |
| SMILES | C1=C(SC2=C1C=NC(C3=NN=C([N]23)C)C4=CC=CC=C4Cl)C(O)C |
| InChI | 1S/C17H15ClN4OS/c1-9(23)14-7-11-8-19-15(12-5-3-4-6-13(12)18)16-21-20-10(2)22(16)17(11)24-14/h3-9,15,23H,1-2H3 |
| InChIKey | BTGCWXDWJAGZML-UHFFFAOYSA-N |
| Density | 1.518g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.554°C at 760 mmHg (Cal.) |
| Flash point | 324.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Hydroxyetizolam |