Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Chloro-1,3-benzothiazole-2-carboxamide |
|---|---|
| Synonyms | 6-chlorobenzo[d]thiazole-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C8H5ClN2OS |
| Molecular Weight | 212.66 |
| CAS Registry Number | 64578-08-1 |
| SMILES | c1cc2c(cc1Cl)sc(n2)C(=O)N |
| InChI | 1S/C8H5ClN2OS/c9-4-1-2-5-6(3-4)13-8(11-5)7(10)12/h1-3H,(H2,10,12) |
| InChIKey | CYTRTPKORBSRSP-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.152°C at 760 mmHg (Cal.) |
| Flash point | 191.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1,3-benzothiazole-2-carboxamide |