Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Aminoacenaphthoquinone |
|---|---|
| Synonyms | 1,2-ACENAPHTHYLENEDIONE, 4-AMINO-; 1,2-Acenaphthylenedione,4-amino-; 4-aminoacenaphthylene-1,2-dione |
| Molecular Structure |  |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 646058-51-7 |
| SMILES | c1cc2cc(cc3c2c(c1)C(=O)C3=O)N |
| InChI | 1S/C12H7NO2/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)11(8)14/h1-5H,13H2 |
| InChIKey | WBGXHPOCCUHTPH-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.742°C at 760 mmHg (Cal.) |
| Flash point | 236.682°C (Cal.) |
| Refractive index | 1.81 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminoacenaphthoquinone |