Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl 2-cyano-3-[(2,6-dimethylphenyl)amino]-3-sulfanylacrylate |
|---|---|
| Synonyms | ethyl 2-cyano-3-(2,6-dimethylanilino)-3-mercaptoacrylate; ethyl-2-cyano-3-(2,6-dimethylanilino)-3-mercaptoacrylate |
| Molecular Structure | ![CAS#: 648409-08-9， Ethyl 2-cyano-3-[(2,6-dimethylphenyl)amino]-3-sulfanylacrylate](/moreStructures/648409-08-9.gif) |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.35 |
| CAS Registry Number | 648409-08-9 |
| SMILES | N#CC(=C(S)Nc1c(cccc1C)C)C(=O)OCC |
| InChI | 1S/C14H16N2O2S/c1-4-18-14(17)11(8-15)13(19)16-12-9(2)6-5-7-10(12)3/h5-7,16,19H,4H2,1-3H3 |
| InChIKey | HIAILPSESUQYPI-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.874°C at 760 mmHg (Cal.) |
| Flash point | 190.194°C (Cal.) |
| Refractive index | 1.6 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-cyano-3-[(2,6-dimethylphenyl)amino]-3-sulfanylacrylate |