Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2-Amino-2-oxoethyl)-1,4-dihydro-3-pyridinecarboxamide |
|---|---|
| Synonyms | NCI60_040604; NSC717765 |
| Molecular Structure |  |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 64881-21-6 |
| SMILES | C1C=CN(C=C1C(=O)N)CC(=O)N |
| InChI | 1S/C8H11N3O2/c9-7(12)5-11-3-1-2-6(4-11)8(10)13/h1,3-4H,2,5H2,(H2,9,12)(H2,10,13) |
| InChIKey | WEJRSYKFMCUCRQ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 255.9±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Amino-2-oxoethyl)-1,4-dihydro-3-pyridinecarboxamide |