Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-(2-Benzoxazolyl)-7-Hydroxy-2H-1-Benzopyran-2-One |
|---|---|
| Synonyms | (3E)-3-(3H-1,3-Benzoxazol-2-Ylidene)Chromene-2,7-Quinone; Cbmicro_024229; Bim-0024198.P001 |
| Molecular Structure |  |
| Molecular Formula | C16H9NO4 |
| Molecular Weight | 279.25 |
| CAS Registry Number | 64887-40-7 |
| EINECS | 265-263-8 |
| SMILES | C2=C1NC(/OC1=CC=C2)=C\4C=C3C(=CC(=O)C=C3)OC4=O |
| InChI | 1S/C16H9NO4/c18-10-6-5-9-7-11(16(19)21-14(9)8-10)15-17-12-3-1-2-4-13(12)20-15/h1-8,17H/b15-11+ |
| InChIKey | ORVZXEDWCROQRH-RVDMUPIBSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.802°C at 760 mmHg (Cal.) |
| Flash point | 234.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Benzoxazolyl)-7-Hydroxy-2H-1-Benzopyran-2-One |