|
CAS#: 6492-18-8 Product: 2,4,5-Trichloro-Phenol Ethyl Ethylphosphonate No suppilers available for the product. |
| Name | 2,4,5-Trichloro-Phenol Ethyl Ethylphosphonate |
|---|---|
| Synonyms | 1,2,4-Trichloro-5-(Ethoxy-Ethyl-Phosphoryl)Oxy-Benzene; Phosphonic Acid, Ethyl-, Ethyl 2,4,5-Trichlorophenyl Ester; Trichloronate Oxon |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Cl3O3P |
| Molecular Weight | 317.54 |
| CAS Registry Number | 6492-18-8 |
| SMILES | C1=C(O[P](=O)(CC)OCC)C(=CC(=C1Cl)Cl)Cl |
| InChI | 1S/C10H12Cl3O3P/c1-3-15-17(14,4-2)16-10-6-8(12)7(11)5-9(10)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZUISTOMUOSRKKE-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.258°C at 760 mmHg (Cal.) |
| Flash point | 274.017°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichloro-Phenol Ethyl Ethylphosphonate |