Online Database of Chemicals from Around the World
|
CAS#: 64985-86-0 Product: 1-Naphthoic Anhydride No suppilers available for the product. |
| Name | 1-Naphthoic Anhydride |
|---|---|
| Synonyms | 1-Naphthalenecarboxylic Acid (1-Naphthyl-Oxomethyl) Ester; Naphthalene-1-Carboxylic Acid Naphthalene-1-Carbonyl Ester; Naphthalen-1-Ylcarbonyl Naphthalene-1-Carboxylate |
| Molecular Structure |  |
| Molecular Formula | C22H14O3 |
| Molecular Weight | 326.35 |
| CAS Registry Number | 64985-86-0 |
| SMILES | C3=CC=C(C(OC(=O)C1=CC=CC2=C1C=CC=C2)=O)C4=C3C=CC=C4 |
| InChI | 1S/C22H14O3/c23-21(19-13-5-9-15-7-1-3-11-17(15)19)25-22(24)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
| InChIKey | BYVCTYDTPSKPRM-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.607°C at 760 mmHg (Cal.) |
| Flash point | 269.237°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Naphthoic Anhydride |