|
CAS#: 650635-68-0 Product: 2,5-Dimethyl-1,3-benzothiazole-4,7-dione No suppilers available for the product. |
| Name | 2,5-Dimethyl-1,3-benzothiazole-4,7-dione |
|---|---|
| Synonyms | 4,7-BENZOTHIAZOLEDIONE, 2,5-DIMETHYL-; AIDS185801; AIDS-185801 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.22 |
| CAS Registry Number | 650635-68-0 |
| SMILES | O=C\2c1sc(nc1C(=O)/C(=C/2)C)C |
| InChI | 1S/C9H7NO2S/c1-4-3-6(11)9-7(8(4)12)10-5(2)13-9/h3H,1-2H3 |
| InChIKey | FUHJILFPCUXBFQ-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.663°C at 760 mmHg (Cal.) |
| Flash point | 162.246°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-1,3-benzothiazole-4,7-dione |