| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemPacific Corp | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 2-(2-Hydroxyethyl)piperidinium (7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)methanesulfonate |
|---|---|
| Synonyms | (S)-2-(Pi |
| Molecular Structure | ![]() |
| Molecular Formula | C17H31NO5S |
| Molecular Weight | 361.50 |
| CAS Registry Number | 652144-68-8 |
| SMILES | CC1(C2CCC1(C(=O)C2)CS(=O)(=O)[O-])C.C1CC[NH2+]C(C1)CCO |
| InChI | 1S/C10H16O4S.C7H15NO/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;9-6-4-7-3-1-2-5-8-7/h7H,3-6H2,1-2H3,(H,12,13,14);7-9H,1-6H2 |
| InChIKey | CWDUSEOMJALTJL-UHFFFAOYSA-N |
| Boiling point | 559.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 292°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Hydroxyethyl)piperidinium (7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)methanesulfonate |