Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(2-Pyridinylcarbonyl)amino]cyclohexanecarboxylic acid |
|---|---|
| Synonyms | 1-(picolinamido)cyclohexanecarboxylic acid |
| Molecular Structure | ![CAS#: 652172-20-8， 1-[(2-Pyridinylcarbonyl)amino]cyclohexanecarboxylic acid](/moreStructures/652172-20-8.gif) |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 652172-20-8 |
| SMILES | c1ccnc(c1)C(=O)NC2(CCCCC2)C(=O)O |
| InChI | 1S/C13H16N2O3/c16-11(10-6-2-5-9-14-10)15-13(12(17)18)7-3-1-4-8-13/h2,5-6,9H,1,3-4,7-8H2,(H,15,16)(H,17,18) |
| InChIKey | HAIWBNGWCWOMEN-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.731°C at 760 mmHg (Cal.) |
| Flash point | 274.172°C (Cal.) |
| Refractive index | 1.58 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2-Pyridinylcarbonyl)amino]cyclohexanecarboxylic acid |