Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (6R)-6-Isopropyl-2,4-piperidinedione |
|---|---|
| Synonyms | (R)-6-isopropylpiperidine-2,4-dione |
| Molecular Structure |  |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.19 |
| CAS Registry Number | 653589-25-4 |
| SMILES | CC(C)[C@H]1CC(=O)CC(=O)N1 |
| InChI | 1S/C8H13NO2/c1-5(2)7-3-6(10)4-8(11)9-7/h5,7H,3-4H2,1-2H3,(H,9,11)/t7-/m1/s1 |
| InChIKey | RGCCRDSIDCNSFJ-SSDOTTSWSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.539°C at 760 mmHg (Cal.) |
| Flash point | 156.587°C (Cal.) |
| Refractive index | 1.461 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6R)-6-Isopropyl-2,4-piperidinedione |