Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 9H-Pyrido[3,4-b]Indole-3-Methanol |
|---|---|
| Synonyms | 9H-$B-Carbolin-3-Ylmethanol; Ninds_000628; 9H-Pyrido(3,4-B)Indole-3-Methanol |
| Molecular Structure | ![CAS#: 65474-79-5， 9H-Pyrido[3,4-b]Indole-3-Methanol](/moreStructures/65474-79-5.gif) |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 |
| CAS Registry Number | 65474-79-5 |
| SMILES | C3=C2C1=C(C=CC=C1)[NH]C2=CN=C3CO |
| InChI | 1S/C12H10N2O/c15-7-8-5-10-9-3-1-2-4-11(9)14-12(10)6-13-8/h1-6,14-15H,7H2 |
| InChIKey | CPBYHTDUBNSBQM-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.03°C at 760 mmHg (Cal.) |
| Flash point | 235.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Pyrido[3,4-b]Indole-3-Methanol |