Online Database of Chemicals from Around the World
|
CAS#: 65487-67-4 Product: alpha-(Trifluoromethyl)Anthracene-9-Methanol No suppilers available for the product. |
| Name | alpha-(Trifluoromethyl)Anthracene-9-Methanol |
|---|---|
| Synonyms | 1-(9-Anthryl)-2,2,2-Trifluoro-Ethanol; 1-(9-Anthryl)-2,2,2-Trifluoroethanol; 1-Anthracen-9-Yl-2,2,2-Trifluoro-Ethanol |
| Molecular Structure |  |
| Molecular Formula | C16H11F3O |
| Molecular Weight | 276.26 |
| CAS Registry Number | 65487-67-4 |
| EINECS | 265-791-9 |
| SMILES | C2=CC=CC3=CC1=CC=CC=C1C(=C23)C(C(F)(F)F)O |
| InChI | 1S/C16H11F3O/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15,20H |
| InChIKey | ICZHJFWIOPYQCA-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Melting point | 142°C (Expl.) |
| Boiling point | 423.119°C at 760 mmHg (Cal.) |
| Flash point | 165.155°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for alpha-(Trifluoromethyl)Anthracene-9-Methanol |