Online Database of Chemicals from Around the World
| Name | 1,2-Anthraquinone |
|---|---|
| Synonyms | 1,2-Anthraquinone; Anthracenedione; 1,2-Anthracenedione (8Ci)(9Ci) |
| Molecular Structure |  |
| Molecular Formula | C14H8O2 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 655-04-9 |
| SMILES | C1=C3C(=CC2=C1C(=O)C(=O)C=C2)C=CC=C3 |
| InChI | 1S/C14H8O2/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16/h1-8H |
| InChIKey | RGHILYZRVFRRNK-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.324°C at 760 mmHg (Cal.) |
| Flash point | 170.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Anthraquinone |
