Online Database of Chemicals from Around the World
|
CAS#: 65510-56-7 Product: 1,1,2,2-Tetrahydroperfluorononadecyl iodide No suppilers available for the product. |
| Name | 1,1,2,2-Tetrahydroperfluorononadecyl iodide |
|---|---|
| Synonyms | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Nonadecafluoro-11-Iodo-Undecane; Undecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Nonadecafluoro-11-Iodo- |
| Molecular Structure |  |
| Molecular Formula | C11H4F19I |
| Molecular Weight | 624.03 |
| CAS Registry Number | 65510-56-7 |
| EINECS | 265-801-1 |
| SMILES | C(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C11H4F19I/c12-3(13,1-2-31)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)30/h1-2H2 |
| InChIKey | UXFIGGWFHDAMOO-UHFFFAOYSA-N |
| Density | 1.875g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.081°C at 760 mmHg (Cal.) |
| Flash point | 110.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2-Tetrahydroperfluorononadecyl iodide |