Online Database of Chemicals from Around the World
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6141-5566 / 800-819-3336 | |||
 |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (2H5)Phenyl(2H2)acetonitrile |
|---|---|
| Synonyms | Benzyl cyanide-d7; BENZYL-D7CYANIDE,98ATOM%D; Phenylacetonitrile-d7 |
| Molecular Structure |  |
| Molecular Formula | C8D7N |
| Molecular Weight | 124.19 |
| CAS Registry Number | 65538-26-3 |
| SMILES | [2H]c1c(c([2H])c([2H])c([2H])c1[2H])C([2H])([2H])C#N |
| InChI | 1S/C8H7N/c9-7-6-8-4-2-1-3-5-8/h1-5H,6H2/i1D,2D,3D,4D,5D,6D2 |
| InChIKey | SUSQOBVLVYHIEX-XZJKGWKKSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 233.499°C at 760 mmHg (Cal.) |
| Flash point | 101.667°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2H5)Phenyl(2H2)acetonitrile |